Chemistry

Chemistry
stevensetiawan
2021-04-25 22:24:03
if you burn your hand on the handle of the hot pot what type of heat transfer took place...
ANSWER
Chemistry
grandescure
2021-04-25 19:16:03
which change in oxidation number indicates oxidation...
ANSWER
Chemistry
Rima01
2021-04-25 17:42:03
How could you separate a mixture of rocks from sand...
ANSWER
Chemistry
makayla2499
2021-04-25 14:45:48
Which element has a larger atomic radius than sulfur? A. Chlorine B. Cadmium C. Fluorine D. Oxygen...
ANSWER
Chemistry
MirianVesper966
2021-04-25 12:36:33
How many moles are represented by 118 grams of cobalt?cobalt has an atomic mass of 58.93amu...
ANSWER
Chemistry
AnabelCondie
2021-04-25 08:18:03
A compound that produces hydrogen ions in solution, is a hydrogen-ion donor, or an electron-pair acceptor....
ANSWER
Chemistry
foxsellers
2021-04-25 03:00:48
Which must be the same when comparing 1 mol of oxygen gas, O2, with 1 mol of carbon monoxide gas, CO?...
ANSWER
Chemistry
anhsrayborn10
2021-04-25 00:39:48
when might a large volume of material have little mass...
ANSWER
Chemistry
td2510
2021-04-24 17:25:03
Use the word "passive transport" in a sentence that demonstrates its meaning...
ANSWER
Chemistry
nikkibaby1
2021-04-24 15:04:03
Which pairs are isomers? CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3. CH3CH(CH3)CH2CH2CH2CH2CH2CH2CH3 and CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3. CH3CH2CH2CH2CH2CH3 a...
ANSWER
Chemistry
damienrose
2021-04-24 12:07:48
2 ways friction is helpful and 2 ways it does not...
ANSWER
Chemistry
sherrieb46
2021-04-24 10:45:33
what is the total charge of a nucleus of a nitrogen atom?...
ANSWER
Chemistry
nitesh
2021-04-24 10:22:03
Which would most likely be joined by an ionic bond?...
ANSWER
Chemistry
oreodunn
2021-04-24 08:48:03
Suggest one reason why it is difficult to dispose of the waste rock...
ANSWER
Chemistry
rossneir
2021-04-24 06:03:33
State one relationship between temperature and the rate of gas production in yeast...
ANSWER
Chemistry
bhai
2021-04-24 01:56:48
Name three acids and three bases and a list an industrial or household use of each...
ANSWER
Chemistry
Trapqueen
2021-04-24 01:21:33
When particles of substance condense on cooler surfaces and turn to liquid,is called?...
ANSWER
Chemistry
heavyelephant197
2021-04-23 23:00:33
One reason that irradiated food is not readily available in most grocery stores is that...
ANSWER
Chemistry
bradjackvony
2021-04-23 22:01:48
what is the decay mode of K-37...
ANSWER
Chemistry
Skieslian
2021-04-23 20:27:48
on a day when the air is still a windmill still possesses what type of energy? why?...
ANSWER
Chemistry
JordanMonasterio
2021-04-23 19:05:33
If 10.3 g of Mg3N2 is treated with water, what volume of gas would be collected at STP...
ANSWER
Chemistry
cmoneymajors
2021-04-23 18:53:48
Imagine you need to make a model that shows the locations of the parts of a sodium atom.Explain which type of model you would use....
ANSWER
Chemistry
Holom517
2021-04-23 13:36:33
Why are cnidocytes important to a sea jelly...
ANSWER
Chemistry
siver
2021-04-23 12:37:48
Iron is a solid, gray metal. Oxygen is a colorless gas. When iron and oxygen chemically combine, rust is made. Rust has a reddish brown color. Why do...
ANSWER
Chemistry
JonManire559
2021-04-23 08:42:48
Is the bond type of PCl3 polar or nonpolar? And is its molecular polarity polar or nonpolar?...
ANSWER